C32H10 — CID 58205344
29-methylhentriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27-tetradecayne (PubChem CID 58205344) has the molecular formula C32H10 and a molecular weight of 394.43 g/mol. Its IUPAC name is 29-methylhentriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27-tetradecayne.
| Compound Name | 29-methylhentriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27-tetradecayne |
|---|---|
| PubChem CID | 58205344 |
| Molecular Formula | C32H10 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 29-methylhentriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27-tetradecayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(C)CC |
| InChI | InChI=1S/C32H10/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32(3)5-2/h1,32H,5H2,2-3H3 |
| InChIKey | DXGOHVPHUAWFLU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|