C22H10 — CID 58841522
19-methylhenicosa-1,3,5,7,9,11,13,15,17-nonayne (PubChem CID 58841522) has the molecular formula C22H10 and a molecular weight of 274.32 g/mol. Its IUPAC name is 19-methylhenicosa-1,3,5,7,9,11,13,15,17-nonayne.
| Compound Name | 19-methylhenicosa-1,3,5,7,9,11,13,15,17-nonayne |
|---|---|
| PubChem CID | 58841522 |
| Molecular Formula | C22H10 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 19-methylhenicosa-1,3,5,7,9,11,13,15,17-nonayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC(C)CC |
| InChI | InChI=1S/C22H10/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(3)5-2/h1,22H,5H2,2-3H3 |
| InChIKey | YVJFGXXDLHSUBX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|