About but-2-yne;ethane;2-methylpropane
but-2-yne;ethane;2-methylpropane (PubChem CID 144864902) has the molecular formula C10H22
and a molecular weight of 142.29 g/mol. Its IUPAC name is but-2-yne;ethane;2-methylpropane.
Molecular Properties
| Compound Name | but-2-yne;ethane;2-methylpropane |
| PubChem CID | 144864902 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | but-2-yne;ethane;2-methylpropane |
| SMILES | CC.CC#CC.CC(C)C |
| InChI | InChI=1S/C4H10.C4H6.C2H6/c1-4(2)3;1-3-4-2;1-2/h4H,1-3H3;1-2H3;1-2H3 |
| InChIKey | ZFIPDPVLMOEROY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-yne;ethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-yne;ethane;2-methylpropane?
The IUPAC name of but-2-yne;ethane;2-methylpropane (CID 144864902) is but-2-yne;ethane;2-methylpropane.
What is the SMILES notation for but-2-yne;ethane;2-methylpropane?
The canonical SMILES for but-2-yne;ethane;2-methylpropane is CC.CC#CC.CC(C)C.
What is the InChIKey of but-2-yne;ethane;2-methylpropane?
The InChIKey is ZFIPDPVLMOEROY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C4H6.C2H6/c1-4(2)3;1-3-4-2;1-2/h4H,1-3H3;1-2H3;1-2H3.
What are the key properties of but-2-yne;ethane;2-methylpropane?
but-2-yne;ethane;2-methylpropane has a molecular weight of 142.29 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;ethane;2-methylpropane is sourced from PubChem (CID 144864902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).