About 1,1-difluoropropane;ethane;2-methylbutane
1,1-difluoropropane;ethane;2-methylbutane (PubChem CID 176705110) has the molecular formula C10H24F2
and a molecular weight of 182.30 g/mol. Its IUPAC name is 1,1-difluoropropane;ethane;2-methylbutane.
Molecular Properties
| Compound Name | 1,1-difluoropropane;ethane;2-methylbutane |
| PubChem CID | 176705110 |
| Molecular Formula | C10H24F2 |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,1-difluoropropane;ethane;2-methylbutane |
| SMILES | CC.CCC(C)C.CCC(F)F |
| InChI | InChI=1S/C5H12.C3H6F2.C2H6/c1-4-5(2)3;1-2-3(4)5;1-2/h5H,4H2,1-3H3;3H,2H2,1H3;1-2H3 |
| InChIKey | ULIRLZJCJUFXRA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoropropane;ethane;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoropropane;ethane;2-methylbutane?
The IUPAC name of 1,1-difluoropropane;ethane;2-methylbutane (CID 176705110) is 1,1-difluoropropane;ethane;2-methylbutane.
What is the SMILES notation for 1,1-difluoropropane;ethane;2-methylbutane?
The canonical SMILES for 1,1-difluoropropane;ethane;2-methylbutane is CC.CCC(C)C.CCC(F)F.
What is the InChIKey of 1,1-difluoropropane;ethane;2-methylbutane?
The InChIKey is ULIRLZJCJUFXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C3H6F2.C2H6/c1-4-5(2)3;1-2-3(4)5;1-2/h5H,4H2,1-3H3;3H,2H2,1H3;1-2H3.
What are the key properties of 1,1-difluoropropane;ethane;2-methylbutane?
1,1-difluoropropane;ethane;2-methylbutane has a molecular weight of 182.30 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoropropane;ethane;2-methylbutane is sourced from PubChem (CID 176705110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).