About 3-ethyl-2-fluoropentane
3-ethyl-2-fluoropentane (PubChem CID 144624740) has the molecular formula C7H15F
and a molecular weight of 118.20 g/mol. Its IUPAC name is 3-ethyl-2-fluoropentane.
Molecular Properties
| Compound Name | 3-ethyl-2-fluoropentane |
| PubChem CID | 144624740 |
| Molecular Formula | C7H15F |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | 3-ethyl-2-fluoropentane |
| SMILES | CCC(CC)C(C)F |
| InChI | InChI=1S/C7H15F/c1-4-7(5-2)6(3)8/h6-7H,4-5H2,1-3H3 |
| InChIKey | XHQCJOCRUUHLFK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-2-fluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-fluoropentane?
The IUPAC name of 3-ethyl-2-fluoropentane (CID 144624740) is 3-ethyl-2-fluoropentane.
What is the SMILES notation for 3-ethyl-2-fluoropentane?
The canonical SMILES for 3-ethyl-2-fluoropentane is CCC(CC)C(C)F.
What is the InChIKey of 3-ethyl-2-fluoropentane?
The InChIKey is XHQCJOCRUUHLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F/c1-4-7(5-2)6(3)8/h6-7H,4-5H2,1-3H3.
What are the key properties of 3-ethyl-2-fluoropentane?
3-ethyl-2-fluoropentane has a molecular weight of 118.20 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-fluoropentane is sourced from PubChem (CID 144624740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).