About 3-fluoro-2-methylpentane;methane
3-fluoro-2-methylpentane;methane (PubChem CID 158695521) has the molecular formula C7H17F
and a molecular weight of 120.21 g/mol. Its IUPAC name is 3-fluoro-2-methylpentane;methane.
Molecular Properties
| Compound Name | 3-fluoro-2-methylpentane;methane |
| PubChem CID | 158695521 |
| Molecular Formula | C7H17F |
| Molecular Weight | 120.21 g/mol |
| Exact Mass | 120.13 |
| IUPAC Name | 3-fluoro-2-methylpentane;methane |
| SMILES | C.CCC(F)C(C)C |
| InChI | InChI=1S/C6H13F.CH4/c1-4-6(7)5(2)3;/h5-6H,4H2,1-3H3;1H4 |
| InChIKey | IGWUYXMAPJRLJR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoro-2-methylpentane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-methylpentane;methane?
The IUPAC name of 3-fluoro-2-methylpentane;methane (CID 158695521) is 3-fluoro-2-methylpentane;methane.
What is the SMILES notation for 3-fluoro-2-methylpentane;methane?
The canonical SMILES for 3-fluoro-2-methylpentane;methane is C.CCC(F)C(C)C.
What is the InChIKey of 3-fluoro-2-methylpentane;methane?
The InChIKey is IGWUYXMAPJRLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F.CH4/c1-4-6(7)5(2)3;/h5-6H,4H2,1-3H3;1H4.
What are the key properties of 3-fluoro-2-methylpentane;methane?
3-fluoro-2-methylpentane;methane has a molecular weight of 120.21 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-methylpentane;methane is sourced from PubChem (CID 158695521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).