C10H21F — CID 134189007
(3R,6S)-3-fluoro-4,6-dimethyloctane (PubChem CID 134189007) has the molecular formula C10H21F and a molecular weight of 160.28 g/mol. Its IUPAC name is (3R,6S)-3-fluoro-4,6-dimethyloctane.
| Compound Name | (3R,6S)-3-fluoro-4,6-dimethyloctane |
|---|---|
| PubChem CID | 134189007 |
| Molecular Formula | C10H21F |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | (3R,6S)-3-fluoro-4,6-dimethyloctane |
| SMILES | CC[C@H](C)CC(C)[C@H](F)CC |
| InChI | InChI=1S/C10H21F/c1-5-8(3)7-9(4)10(11)6-2/h8-10H,5-7H2,1-4H3/t8-,9?,10+/m0/s1 |
| InChIKey | VKSLIEDHTBUMRT-DJBFQZMMSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |