C8H17F — CID 123953899
1-fluoro-2,4-dimethylhexane (PubChem CID 123953899) has the molecular formula C8H17F and a molecular weight of 132.22 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethylhexane.
| Compound Name | 1-fluoro-2,4-dimethylhexane |
|---|---|
| PubChem CID | 123953899 |
| Molecular Formula | C8H17F |
| Molecular Weight | 132.22 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1-fluoro-2,4-dimethylhexane |
| SMILES | CCC(C)CC(C)CF |
| InChI | InChI=1S/C8H17F/c1-4-7(2)5-8(3)6-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | AIBXHMLRCJNUDB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |