C11H26 — CID 143348383
2,4-dimethylhexane;propane (PubChem CID 143348383) has the molecular formula C11H26 and a molecular weight of 158.33 g/mol. Its IUPAC name is 2,4-dimethylhexane;propane.
| Compound Name | 2,4-dimethylhexane;propane |
|---|---|
| PubChem CID | 143348383 |
| Molecular Formula | C11H26 |
| Molecular Weight | 158.33 g/mol |
| Exact Mass | 158.20 |
| IUPAC Name | 2,4-dimethylhexane;propane |
| SMILES | CCC.CCC(C)CC(C)C |
| InChI | InChI=1S/C8H18.C3H8/c1-5-8(4)6-7(2)3;1-3-2/h7-8H,5-6H2,1-4H3;3H2,1-2H3 |
| InChIKey | WBURKKKJMIPLTK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |