C14H30 — CID 54224604
2,4,6,8-tetramethyldecane (PubChem CID 54224604) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 2,4,6,8-tetramethyldecane.
| Compound Name | 2,4,6,8-tetramethyldecane |
|---|---|
| PubChem CID | 54224604 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 2,4,6,8-tetramethyldecane |
| SMILES | CCC(C)CC(C)CC(C)CC(C)C |
| InChI | InChI=1S/C14H30/c1-7-12(4)9-14(6)10-13(5)8-11(2)3/h11-14H,7-10H2,1-6H3 |
| InChIKey | IVLOIULIPCQYDN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |