C17H36O — CID 54763066
(2S,4R,6R,8R,10R)-2,4,6,8,10-pentamethyldodecan-1-ol (PubChem CID 54763066) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is (2S,4R,6R,8R,10R)-2,4,6,8,10-pentamethyldodecan-1-ol.
| Compound Name | (2S,4R,6R,8R,10R)-2,4,6,8,10-pentamethyldodecan-1-ol |
|---|---|
| PubChem CID | 54763066 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | (2S,4R,6R,8R,10R)-2,4,6,8,10-pentamethyldodecan-1-ol |
| SMILES | CC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)CO |
| InChI | InChI=1S/C17H36O/c1-7-13(2)8-14(3)9-15(4)10-16(5)11-17(6)12-18/h13-18H,7-12H2,1-6H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | NMKKIXGMAYQBKP-HHARLNAUSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |