C9H20O — CID 99134990
(3S,5R)-3,5-dimethylheptan-1-ol (PubChem CID 99134990) has the molecular formula C9H20O and a molecular weight of 144.26 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethylheptan-1-ol.
| Compound Name | (3S,5R)-3,5-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 99134990 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | (3S,5R)-3,5-dimethylheptan-1-ol |
| SMILES | CC[C@@H](C)C[C@H](C)CCO |
| InChI | InChI=1S/C9H20O/c1-4-8(2)7-9(3)5-6-10/h8-10H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | HBUKPSFSXBTFFW-RKDXNWHRSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |