C11H24O2 — CID 129322484
(2R,4S,6S)-2,4-dimethylnonane-1,6-diol (PubChem CID 129322484) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (2R,4S,6S)-2,4-dimethylnonane-1,6-diol.
| Compound Name | (2R,4S,6S)-2,4-dimethylnonane-1,6-diol |
|---|---|
| PubChem CID | 129322484 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (2R,4S,6S)-2,4-dimethylnonane-1,6-diol |
| SMILES | CCC[C@H](O)C[C@@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C11H24O2/c1-4-5-11(13)7-9(2)6-10(3)8-12/h9-13H,4-8H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | GHJSXOBUPWSSJI-AXFHLTTASA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |