About 2-methylpentan-1-ol;4-methylpentan-2-ol
2-methylpentan-1-ol;4-methylpentan-2-ol (PubChem CID 160710819) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is 2-methylpentan-1-ol;4-methylpentan-2-ol.
Molecular Properties
| Compound Name | 2-methylpentan-1-ol;4-methylpentan-2-ol |
| PubChem CID | 160710819 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 2-methylpentan-1-ol;4-methylpentan-2-ol |
| SMILES | CC(C)CC(C)O.CCCC(C)CO |
| InChI | InChI=1S/2C6H14O/c1-5(2)4-6(3)7;1-3-4-6(2)5-7/h5-7H,4H2,1-3H3;6-7H,3-5H2,1-2H3 |
| InChIKey | RRVHYCIYDCQSDQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpentan-1-ol;4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-1-ol;4-methylpentan-2-ol?
The IUPAC name of 2-methylpentan-1-ol;4-methylpentan-2-ol (CID 160710819) is 2-methylpentan-1-ol;4-methylpentan-2-ol.
What is the SMILES notation for 2-methylpentan-1-ol;4-methylpentan-2-ol?
The canonical SMILES for 2-methylpentan-1-ol;4-methylpentan-2-ol is CC(C)CC(C)O.CCCC(C)CO.
What is the InChIKey of 2-methylpentan-1-ol;4-methylpentan-2-ol?
The InChIKey is RRVHYCIYDCQSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14O/c1-5(2)4-6(3)7;1-3-4-6(2)5-7/h5-7H,4H2,1-3H3;6-7H,3-5H2,1-2H3.
What are the key properties of 2-methylpentan-1-ol;4-methylpentan-2-ol?
2-methylpentan-1-ol;4-methylpentan-2-ol has a molecular weight of 204.35 g/mol, XLogP of 2.83, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-1-ol;4-methylpentan-2-ol is sourced from PubChem (CID 160710819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).