C8H20O3 — CID 158261198
ethane-1,2-diol;4-methylpentan-2-ol (PubChem CID 158261198) has the molecular formula C8H20O3 and a molecular weight of 164.24 g/mol. Its IUPAC name is ethane-1,2-diol;4-methylpentan-2-ol.
| Compound Name | ethane-1,2-diol;4-methylpentan-2-ol |
|---|---|
| PubChem CID | 158261198 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | ethane-1,2-diol;4-methylpentan-2-ol |
| SMILES | CC(C)CC(C)O.OCCO |
| InChI | InChI=1S/C6H14O.C2H6O2/c1-5(2)4-6(3)7;3-1-2-4/h5-7H,4H2,1-3H3;3-4H,1-2H2 |
| InChIKey | GHWVFBDJOBIMDZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |