About azane;2-methylpentan-1-ol;dihydrochloride
azane;2-methylpentan-1-ol;dihydrochloride (PubChem CID 174415462) has the molecular formula C6H19Cl2NO
and a molecular weight of 192.13 g/mol. Its IUPAC name is azane;2-methylpentan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | azane;2-methylpentan-1-ol;dihydrochloride |
| PubChem CID | 174415462 |
| Molecular Formula | C6H19Cl2NO |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | azane;2-methylpentan-1-ol;dihydrochloride |
| SMILES | CCCC(C)CO.Cl.Cl.N |
| InChI | InChI=1S/C6H14O.2ClH.H3N/c1-3-4-6(2)5-7;;;/h6-7H,3-5H2,1-2H3;2*1H;1H3 |
| InChIKey | OJWGJTSLDNJCPK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-methylpentan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylpentan-1-ol;dihydrochloride?
The IUPAC name of azane;2-methylpentan-1-ol;dihydrochloride (CID 174415462) is azane;2-methylpentan-1-ol;dihydrochloride.
What is the SMILES notation for azane;2-methylpentan-1-ol;dihydrochloride?
The canonical SMILES for azane;2-methylpentan-1-ol;dihydrochloride is CCCC(C)CO.Cl.Cl.N.
What is the InChIKey of azane;2-methylpentan-1-ol;dihydrochloride?
The InChIKey is OJWGJTSLDNJCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.2ClH.H3N/c1-3-4-6(2)5-7;;;/h6-7H,3-5H2,1-2H3;2*1H;1H3.
What are the key properties of azane;2-methylpentan-1-ol;dihydrochloride?
azane;2-methylpentan-1-ol;dihydrochloride has a molecular weight of 192.13 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylpentan-1-ol;dihydrochloride is sourced from PubChem (CID 174415462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).