C12H26O2 — CID 10655741
2-[(2R,4R)-2,4-dimethylheptyl]propane-1,3-diol (PubChem CID 10655741) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-[(2R,4R)-2,4-dimethylheptyl]propane-1,3-diol.
| Compound Name | 2-[(2R,4R)-2,4-dimethylheptyl]propane-1,3-diol |
|---|---|
| PubChem CID | 10655741 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2-[(2R,4R)-2,4-dimethylheptyl]propane-1,3-diol |
| SMILES | CCC[C@@H](C)C[C@@H](C)CC(CO)CO |
| InChI | InChI=1S/C12H26O2/c1-4-5-10(2)6-11(3)7-12(8-13)9-14/h10-14H,4-9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | HANKDRYIMQEFKY-GHMZBOCLSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |