C15H29BrO3 — CID 10568923
[(4R,6S)-2-(hydroxymethyl)-4,6-dimethylnonyl] 2-bromopropanoate (PubChem CID 10568923) has the molecular formula C15H29BrO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is [(4R,6S)-2-(hydroxymethyl)-4,6-dimethylnonyl] 2-bromopropanoate.
| Compound Name | [(4R,6S)-2-(hydroxymethyl)-4,6-dimethylnonyl] 2-bromopropanoate |
|---|---|
| PubChem CID | 10568923 |
| Molecular Formula | C15H29BrO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [(4R,6S)-2-(hydroxymethyl)-4,6-dimethylnonyl] 2-bromopropanoate |
| SMILES | CCC[C@H](C)C[C@@H](C)CC(CO)COC(=O)C(C)Br |
| InChI | InChI=1S/C15H29BrO3/c1-5-6-11(2)7-12(3)8-14(9-17)10-19-15(18)13(4)16/h11-14,17H,5-10H2,1-4H3/t11-,12+,13?,14?/m0/s1 |
| InChIKey | UWDFLOPOFXKBEK-MRFVTOPCSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|