C10H22O — CID 13109020
(2S,4R)-2,4,6-trimethylheptan-1-ol (PubChem CID 13109020) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is (2S,4R)-2,4,6-trimethylheptan-1-ol.
| Compound Name | (2S,4R)-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 13109020 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | (2S,4R)-2,4,6-trimethylheptan-1-ol |
| SMILES | CC(C)C[C@@H](C)C[C@H](C)CO |
| InChI | InChI=1S/C10H22O/c1-8(2)5-9(3)6-10(4)7-11/h8-11H,5-7H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | SPZKOUBIZRBFQY-ZJUUUORDSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |