About (2S)-4-methylpentane-1,2-diol;sulfane
(2S)-4-methylpentane-1,2-diol;sulfane (PubChem CID 159079830) has the molecular formula C6H16O2S
and a molecular weight of 152.26 g/mol. Its IUPAC name is (2S)-4-methylpentane-1,2-diol;sulfane.
Molecular Properties
| Compound Name | (2S)-4-methylpentane-1,2-diol;sulfane |
| PubChem CID | 159079830 |
| Molecular Formula | C6H16O2S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (2S)-4-methylpentane-1,2-diol;sulfane |
| SMILES | CC(C)C[C@H](O)CO.S |
| InChI | InChI=1S/C6H14O2.H2S/c1-5(2)3-6(8)4-7;/h5-8H,3-4H2,1-2H3;1H2/t6-;/m0./s1 |
| InChIKey | KASFRBNKCRWNBK-RGMNGODLSA-N |
| XLogP | 0.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-methylpentane-1,2-diol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methylpentane-1,2-diol;sulfane?
The IUPAC name of (2S)-4-methylpentane-1,2-diol;sulfane (CID 159079830) is (2S)-4-methylpentane-1,2-diol;sulfane.
What is the SMILES notation for (2S)-4-methylpentane-1,2-diol;sulfane?
The canonical SMILES for (2S)-4-methylpentane-1,2-diol;sulfane is CC(C)C[C@H](O)CO.S.
What is the InChIKey of (2S)-4-methylpentane-1,2-diol;sulfane?
The InChIKey is KASFRBNKCRWNBK-RGMNGODLSA-N. The full InChI is InChI=1S/C6H14O2.H2S/c1-5(2)3-6(8)4-7;/h5-8H,3-4H2,1-2H3;1H2/t6-;/m0./s1.
What are the key properties of (2S)-4-methylpentane-1,2-diol;sulfane?
(2S)-4-methylpentane-1,2-diol;sulfane has a molecular weight of 152.26 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methylpentane-1,2-diol;sulfane is sourced from PubChem (CID 159079830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).