C5H12O4P+ — CID 123199268
4,5-dihydroxypentan-2-yl-hydroxy-oxophosphanium (PubChem CID 123199268) has the molecular formula C5H12O4P+ and a molecular weight of 167.12 g/mol. Its IUPAC name is 4,5-dihydroxypentan-2-yl-hydroxy-oxophosphanium.
| Compound Name | 4,5-dihydroxypentan-2-yl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 123199268 |
| Molecular Formula | C5H12O4P+ |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4,5-dihydroxypentan-2-yl-hydroxy-oxophosphanium |
| SMILES | CC(CC(O)CO)[P+](=O)O |
| InChI | InChI=1S/C5H11O4P/c1-4(10(8)9)2-5(7)3-6/h4-7H,2-3H2,1H3/p+1 |
| InChIKey | LNRREMXHQCKRPZ-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|