C3H10O6P+ — CID 87878528
dihydroxy(oxo)phosphanium;propane-1,2,3-triol (PubChem CID 87878528) has the molecular formula C3H10O6P+ and a molecular weight of 173.08 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;propane-1,2,3-triol.
| Compound Name | dihydroxy(oxo)phosphanium;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87878528 |
| Molecular Formula | C3H10O6P+ |
| Molecular Weight | 173.08 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | dihydroxy(oxo)phosphanium;propane-1,2,3-triol |
| SMILES | O=[P+](O)O.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.HO3P/c4-1-3(6)2-5;1-4(2)3/h3-6H,1-2H2;(H-,1,2,3)/p+1 |
| InChIKey | UXGHICFMVMSQFM-UHFFFAOYSA-O |
| XLogP | -2.04 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.08 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|