C10H18O3 — CID 142382637
(7S)-7,8-dihydroxy-2,5-dimethyloct-1-en-1-one (PubChem CID 142382637) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (7S)-7,8-dihydroxy-2,5-dimethyloct-1-en-1-one.
| Compound Name | (7S)-7,8-dihydroxy-2,5-dimethyloct-1-en-1-one |
|---|---|
| PubChem CID | 142382637 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (7S)-7,8-dihydroxy-2,5-dimethyloct-1-en-1-one |
| SMILES | CC(=C=O)CCC(C)C[C@H](O)CO |
| InChI | InChI=1S/C10H18O3/c1-8(5-10(13)7-12)3-4-9(2)6-11/h8,10,12-13H,3-5,7H2,1-2H3/t8?,10-/m0/s1 |
| InChIKey | XVHLEOWVKOQGLM-HTLJXXAVSA-N |
| XLogP | 0.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|