C5H13IO4 — CID 175431347
1-iodoethanol;propane-1,2,3-triol (PubChem CID 175431347) has the molecular formula C5H13IO4 and a molecular weight of 264.06 g/mol. Its IUPAC name is 1-iodoethanol;propane-1,2,3-triol.
| Compound Name | 1-iodoethanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 175431347 |
| Molecular Formula | C5H13IO4 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 1-iodoethanol;propane-1,2,3-triol |
| SMILES | CC(O)I.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.C2H5IO/c4-1-3(6)2-5;1-2(3)4/h3-6H,1-2H2;2,4H,1H3 |
| InChIKey | OWAQTVBJJHWSMO-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|