C11H24O2 — CID 15640449
(4R,6R)-2,8-dimethylnonane-4,6-diol (PubChem CID 15640449) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (4R,6R)-2,8-dimethylnonane-4,6-diol.
| Compound Name | (4R,6R)-2,8-dimethylnonane-4,6-diol |
|---|---|
| PubChem CID | 15640449 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (4R,6R)-2,8-dimethylnonane-4,6-diol |
| SMILES | CC(C)C[C@@H](O)C[C@H](O)CC(C)C |
| InChI | InChI=1S/C11H24O2/c1-8(2)5-10(12)7-11(13)6-9(3)4/h8-13H,5-7H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | DXGWRDOUAXXHPF-GHMZBOCLSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |