C7H16O2 — CID 10964552
2,4-dimethylpentane-1,5-diol (PubChem CID 10964552) has the molecular formula C7H16O2 and a molecular weight of 132.20 g/mol. Its IUPAC name is 2,4-dimethylpentane-1,5-diol.
| Compound Name | 2,4-dimethylpentane-1,5-diol |
|---|---|
| PubChem CID | 10964552 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | 2,4-dimethylpentane-1,5-diol |
| SMILES | CC(CO)CC(C)CO |
| InChI | InChI=1S/C7H16O2/c1-6(4-8)3-7(2)5-9/h6-9H,3-5H2,1-2H3 |
| InChIKey | ZJWDJIVISLUQQZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |