C6H15NO2 — CID 72526972
2-amino-4-methylpentane-1,5-diol (PubChem CID 72526972) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-amino-4-methylpentane-1,5-diol.
| Compound Name | 2-amino-4-methylpentane-1,5-diol |
|---|---|
| PubChem CID | 72526972 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-amino-4-methylpentane-1,5-diol |
| SMILES | CC(CO)CC(N)CO |
| InChI | InChI=1S/C6H15NO2/c1-5(3-8)2-6(7)4-9/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | SSTDTFPYFIDPFC-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |