C6H18N4O — CID 163608286
2,4,5,6-tetraaminohexan-1-ol (PubChem CID 163608286) has the molecular formula C6H18N4O and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,4,5,6-tetraaminohexan-1-ol.
| Compound Name | 2,4,5,6-tetraaminohexan-1-ol |
|---|---|
| PubChem CID | 163608286 |
| Molecular Formula | C6H18N4O |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.15 |
| IUPAC Name | 2,4,5,6-tetraaminohexan-1-ol |
| SMILES | NCC(N)C(N)CC(N)CO |
| InChI | InChI=1S/C6H18N4O/c7-2-6(10)5(9)1-4(8)3-11/h4-6,11H,1-3,7-10H2 |
| InChIKey | HDRRPDJOLABVBB-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |