C13H31N3O6 — CID 89285463
(2S)-4-amino-3-[(1S)-1-[(2R,5S)-3,5-diamino-1-hydroxyheptan-2-yl]oxy-2-hydroxyethoxy]butane-1,2-diol (PubChem CID 89285463) has the molecular formula C13H31N3O6 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S)-4-amino-3-[(1S)-1-[(2R,5S)-3,5-diamino-1-hydroxyheptan-2-yl]oxy-2-hydroxyethoxy]butane-1,2-diol.
| Compound Name | (2S)-4-amino-3-[(1S)-1-[(2R,5S)-3,5-diamino-1-hydroxyheptan-2-yl]oxy-2-hydroxyethoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 89285463 |
| Molecular Formula | C13H31N3O6 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2S)-4-amino-3-[(1S)-1-[(2R,5S)-3,5-diamino-1-hydroxyheptan-2-yl]oxy-2-hydroxyethoxy]butane-1,2-diol |
| SMILES | CC[C@H](N)CC(N)[C@H](CO)O[C@H](CO)OC(CN)[C@@H](O)CO |
| InChI | InChI=1S/C13H31N3O6/c1-2-8(15)3-9(16)12(6-18)22-13(7-19)21-11(4-14)10(20)5-17/h8-13,17-20H,2-7,14-16H2,1H3/t8-,9?,10-,11?,12-,13+/m0/s1 |
| InChIKey | WYOPJPXEQHJKFV-FHCYEZAOSA-N |
| XLogP | -3.17 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|