C8H20N2 — CID 145088114
(3S)-2-methylheptane-3,5-diamine (PubChem CID 145088114) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (3S)-2-methylheptane-3,5-diamine.
| Compound Name | (3S)-2-methylheptane-3,5-diamine |
|---|---|
| PubChem CID | 145088114 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (3S)-2-methylheptane-3,5-diamine |
| SMILES | CCC(N)C[C@H](N)C(C)C |
| InChI | InChI=1S/C8H20N2/c1-4-7(9)5-8(10)6(2)3/h6-8H,4-5,9-10H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | QAATXRZDUGIEKI-MQWKRIRWSA-N |
| XLogP | 1.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |