About pentan-3-amine;hydroiodide
pentan-3-amine;hydroiodide (PubChem CID 173436389) has the molecular formula C5H14IN
and a molecular weight of 215.08 g/mol. Its IUPAC name is pentan-3-amine;hydroiodide.
Molecular Properties
| Compound Name | pentan-3-amine;hydroiodide |
| PubChem CID | 173436389 |
| Molecular Formula | C5H14IN |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | pentan-3-amine;hydroiodide |
| SMILES | CCC(N)CC.I |
| InChI | InChI=1S/C5H13N.HI/c1-3-5(6)4-2;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | HKTKRUDGNVRTAR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-amine;hydroiodide?
The IUPAC name of pentan-3-amine;hydroiodide (CID 173436389) is pentan-3-amine;hydroiodide.
What is the SMILES notation for pentan-3-amine;hydroiodide?
The canonical SMILES for pentan-3-amine;hydroiodide is CCC(N)CC.I.
What is the InChIKey of pentan-3-amine;hydroiodide?
The InChIKey is HKTKRUDGNVRTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.HI/c1-3-5(6)4-2;/h5H,3-4,6H2,1-2H3;1H.
What are the key properties of pentan-3-amine;hydroiodide?
pentan-3-amine;hydroiodide has a molecular weight of 215.08 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-amine;hydroiodide is sourced from PubChem (CID 173436389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).