About (5R)-heptane-3,5-diamine
(5R)-heptane-3,5-diamine (PubChem CID 118180613) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is (5R)-heptane-3,5-diamine.
Molecular Properties
| Compound Name | (5R)-heptane-3,5-diamine |
| PubChem CID | 118180613 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | (5R)-heptane-3,5-diamine |
| SMILES | CCC(N)C[C@H](N)CC |
| InChI | InChI=1S/C7H18N2/c1-3-6(8)5-7(9)4-2/h6-7H,3-5,8-9H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | GZVVDCYSRRRWCX-ULUSZKPHSA-N |
| XLogP | 0.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-heptane-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-heptane-3,5-diamine?
The IUPAC name of (5R)-heptane-3,5-diamine (CID 118180613) is (5R)-heptane-3,5-diamine.
What is the SMILES notation for (5R)-heptane-3,5-diamine?
The canonical SMILES for (5R)-heptane-3,5-diamine is CCC(N)C[C@H](N)CC.
What is the InChIKey of (5R)-heptane-3,5-diamine?
The InChIKey is GZVVDCYSRRRWCX-ULUSZKPHSA-N. The full InChI is InChI=1S/C7H18N2/c1-3-6(8)5-7(9)4-2/h6-7H,3-5,8-9H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of (5R)-heptane-3,5-diamine?
(5R)-heptane-3,5-diamine has a molecular weight of 130.23 g/mol, XLogP of 0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-heptane-3,5-diamine is sourced from PubChem (CID 118180613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).