C7H19N3 — CID 89360326
heptane-1,3,5-triamine (PubChem CID 89360326) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is heptane-1,3,5-triamine.
| Compound Name | heptane-1,3,5-triamine |
|---|---|
| PubChem CID | 89360326 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | heptane-1,3,5-triamine |
| SMILES | CCC(N)CC(N)CCN |
| InChI | InChI=1S/C7H19N3/c1-2-6(9)5-7(10)3-4-8/h6-7H,2-5,8-10H2,1H3 |
| InChIKey | KMSIOBACEFAUGZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |