About 2-propylhexane-1,4-diamine
2-propylhexane-1,4-diamine (PubChem CID 174915124) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 2-propylhexane-1,4-diamine.
Molecular Properties
| Compound Name | 2-propylhexane-1,4-diamine |
| PubChem CID | 174915124 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 2-propylhexane-1,4-diamine |
| SMILES | CCCC(CN)CC(N)CC |
| InChI | InChI=1S/C9H22N2/c1-3-5-8(7-10)6-9(11)4-2/h8-9H,3-7,10-11H2,1-2H3 |
| InChIKey | UDQOHUAPVCZBAZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylhexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexane-1,4-diamine?
The IUPAC name of 2-propylhexane-1,4-diamine (CID 174915124) is 2-propylhexane-1,4-diamine.
What is the SMILES notation for 2-propylhexane-1,4-diamine?
The canonical SMILES for 2-propylhexane-1,4-diamine is CCCC(CN)CC(N)CC.
What is the InChIKey of 2-propylhexane-1,4-diamine?
The InChIKey is UDQOHUAPVCZBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2/c1-3-5-8(7-10)6-9(11)4-2/h8-9H,3-7,10-11H2,1-2H3.
What are the key properties of 2-propylhexane-1,4-diamine?
2-propylhexane-1,4-diamine has a molecular weight of 158.29 g/mol, XLogP of 1.49, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexane-1,4-diamine is sourced from PubChem (CID 174915124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).