C8H22N4 — CID 18680656
octane-1,3,6,8-tetramine (PubChem CID 18680656) has the molecular formula C8H22N4 and a molecular weight of 174.29 g/mol. Its IUPAC name is octane-1,3,6,8-tetramine.
| Compound Name | octane-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 18680656 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | octane-1,3,6,8-tetramine |
| SMILES | NCCC(N)CCC(N)CCN |
| InChI | InChI=1S/C8H22N4/c9-5-3-7(11)1-2-8(12)4-6-10/h7-8H,1-6,9-12H2 |
| InChIKey | DFKIUJUBDRIUBY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |