C7H20N2O2Si — CID 123921736
5-dimethoxysilylpentane-1,3-diamine (PubChem CID 123921736) has the molecular formula C7H20N2O2Si and a molecular weight of 192.33 g/mol. Its IUPAC name is 5-dimethoxysilylpentane-1,3-diamine.
| Compound Name | 5-dimethoxysilylpentane-1,3-diamine |
|---|---|
| PubChem CID | 123921736 |
| Molecular Formula | C7H20N2O2Si |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-dimethoxysilylpentane-1,3-diamine |
| SMILES | CO[SiH](CCC(N)CCN)OC |
| InChI | InChI=1S/C7H20N2O2Si/c1-10-12(11-2)6-4-7(9)3-5-8/h7,12H,3-6,8-9H2,1-2H3 |
| InChIKey | SQTSHRKDEDOZME-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|