C13H32N4O2 — CID 178166469
5-[2-(3,5-diaminopentoxy)propan-2-yloxy]pentane-1,3-diamine (PubChem CID 178166469) has the molecular formula C13H32N4O2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 5-[2-(3,5-diaminopentoxy)propan-2-yloxy]pentane-1,3-diamine.
| Compound Name | 5-[2-(3,5-diaminopentoxy)propan-2-yloxy]pentane-1,3-diamine |
|---|---|
| PubChem CID | 178166469 |
| Molecular Formula | C13H32N4O2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 5-[2-(3,5-diaminopentoxy)propan-2-yloxy]pentane-1,3-diamine |
| SMILES | CC(C)(OCCC(N)CCN)OCCC(N)CCN |
| InChI | InChI=1S/C13H32N4O2/c1-13(2,18-9-5-11(16)3-7-14)19-10-6-12(17)4-8-15/h11-12H,3-10,14-17H2,1-2H3 |
| InChIKey | YREYGTZDYXMJML-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|