C9H26N4 — CID 142330050
ethane;(5R)-heptane-1,3,5,7-tetramine (PubChem CID 142330050) has the molecular formula C9H26N4 and a molecular weight of 190.33 g/mol. Its IUPAC name is ethane;(5R)-heptane-1,3,5,7-tetramine.
| Compound Name | ethane;(5R)-heptane-1,3,5,7-tetramine |
|---|---|
| PubChem CID | 142330050 |
| Molecular Formula | C9H26N4 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.22 |
| IUPAC Name | ethane;(5R)-heptane-1,3,5,7-tetramine |
| SMILES | CC.NCCC(N)C[C@H](N)CCN |
| InChI | InChI=1S/C7H20N4.C2H6/c8-3-1-6(10)5-7(11)2-4-9;1-2/h6-7H,1-5,8-11H2;1-2H3/t6-,7?;/m1./s1 |
| InChIKey | ZEJUHIKUCIXXDF-JVEOKNEYSA-N |
| XLogP | -0.25 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |