C5H15N3 — CID 18366520
pentane-1,3,4-triamine (PubChem CID 18366520) has the molecular formula C5H15N3 and a molecular weight of 117.20 g/mol. Its IUPAC name is pentane-1,3,4-triamine.
| Compound Name | pentane-1,3,4-triamine |
|---|---|
| PubChem CID | 18366520 |
| Molecular Formula | C5H15N3 |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | pentane-1,3,4-triamine |
| SMILES | CC(N)C(N)CCN |
| InChI | InChI=1S/C5H15N3/c1-4(7)5(8)2-3-6/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | BLZCCGIIJBNCTG-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |