C8H22N2O3Si — CID 174577695
(4R)-3-trimethoxysilylpentane-1,4-diamine (PubChem CID 174577695) has the molecular formula C8H22N2O3Si and a molecular weight of 222.36 g/mol. Its IUPAC name is (4R)-3-trimethoxysilylpentane-1,4-diamine.
| Compound Name | (4R)-3-trimethoxysilylpentane-1,4-diamine |
|---|---|
| PubChem CID | 174577695 |
| Molecular Formula | C8H22N2O3Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (4R)-3-trimethoxysilylpentane-1,4-diamine |
| SMILES | CO[Si](OC)(OC)C(CCN)[C@@H](C)N |
| InChI | InChI=1S/C8H22N2O3Si/c1-7(10)8(5-6-9)14(11-2,12-3)13-4/h7-8H,5-6,9-10H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | YFBFTYOHSBVSKO-GVHYBUMESA-N |
| XLogP | -0.07 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|