C5H16N2O2Si — CID 173135737
4-dihydroxysilylpentane-1,3-diamine (PubChem CID 173135737) has the molecular formula C5H16N2O2Si and a molecular weight of 164.28 g/mol. Its IUPAC name is 4-dihydroxysilylpentane-1,3-diamine.
| Compound Name | 4-dihydroxysilylpentane-1,3-diamine |
|---|---|
| PubChem CID | 173135737 |
| Molecular Formula | C5H16N2O2Si |
| Molecular Weight | 164.28 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 4-dihydroxysilylpentane-1,3-diamine |
| SMILES | CC(C(N)CCN)[SiH](O)O |
| InChI | InChI=1S/C5H16N2O2Si/c1-4(10(8)9)5(7)2-3-6/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | WFGHMRYZUSADRS-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|