C5H14N2 — CID 51382069
(2S)-2-methylbutane-1,4-diamine (PubChem CID 51382069) has the molecular formula C5H14N2 and a molecular weight of 102.18 g/mol. Its IUPAC name is (2S)-2-methylbutane-1,4-diamine.
| Compound Name | (2S)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 51382069 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | (2S)-2-methylbutane-1,4-diamine |
| SMILES | C[C@H](CN)CCN |
| InChI | InChI=1S/C5H14N2/c1-5(4-7)2-3-6/h5H,2-4,6-7H2,1H3/t5-/m0/s1 |
| InChIKey | GGQJPAQXCYUEKB-YFKPBYRVSA-N |
| XLogP | -0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |