C9H21N — CID 13329794
(2S)-2,6-dimethylheptan-1-amine (PubChem CID 13329794) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is (2S)-2,6-dimethylheptan-1-amine.
| Compound Name | (2S)-2,6-dimethylheptan-1-amine |
|---|---|
| PubChem CID | 13329794 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | (2S)-2,6-dimethylheptan-1-amine |
| SMILES | CC(C)CCC[C@H](C)CN |
| InChI | InChI=1S/C9H21N/c1-8(2)5-4-6-9(3)7-10/h8-9H,4-7,10H2,1-3H3/t9-/m0/s1 |
| InChIKey | HWDRGAFTIGABCW-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |