C11H25N — CID 83168373
4,8-dimethylnonan-2-amine (PubChem CID 83168373) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is 4,8-dimethylnonan-2-amine.
| Compound Name | 4,8-dimethylnonan-2-amine |
|---|---|
| PubChem CID | 83168373 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | 4,8-dimethylnonan-2-amine |
| SMILES | CC(C)CCCC(C)CC(C)N |
| InChI | InChI=1S/C11H25N/c1-9(2)6-5-7-10(3)8-11(4)12/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | GNKUSJYSVILDSR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |