C30H62 — CID 71327414
2,4,10,15,19,23-hexamethyltetracosane (PubChem CID 71327414) has the molecular formula C30H62 and a molecular weight of 422.83 g/mol. Its IUPAC name is 2,4,10,15,19,23-hexamethyltetracosane.
| Compound Name | 2,4,10,15,19,23-hexamethyltetracosane |
|---|---|
| PubChem CID | 71327414 |
| Molecular Formula | C30H62 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.49 |
| IUPAC Name | 2,4,10,15,19,23-hexamethyltetracosane |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCCCC(C)CC(C)C |
| InChI | InChI=1S/C30H62/c1-25(2)16-14-21-29(7)23-15-22-28(6)19-13-12-18-27(5)17-10-9-11-20-30(8)24-26(3)4/h25-30H,9-24H2,1-8H3 |
| InChIKey | NEDTVDCAKXOFPN-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|