C20H44 — CID 160877277
2,7-dimethyloctane;2,4,6-trimethylheptane (PubChem CID 160877277) has the molecular formula C20H44 and a molecular weight of 284.57 g/mol. Its IUPAC name is 2,7-dimethyloctane;2,4,6-trimethylheptane.
| Compound Name | 2,7-dimethyloctane;2,4,6-trimethylheptane |
|---|---|
| PubChem CID | 160877277 |
| Molecular Formula | C20H44 |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 284.34 |
| IUPAC Name | 2,7-dimethyloctane;2,4,6-trimethylheptane |
| SMILES | CC(C)CC(C)CC(C)C.CC(C)CCCCC(C)C |
| InChI | InChI=1S/2C10H22/c1-8(2)6-10(5)7-9(3)4;1-9(2)7-5-6-8-10(3)4/h8-10H,6-7H2,1-5H3;9-10H,5-8H2,1-4H3 |
| InChIKey | SMOHKWACOBPTGK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|