About 4-bromo-2,9-dimethyldecane
4-bromo-2,9-dimethyldecane (PubChem CID 83161521) has the molecular formula C12H25Br
and a molecular weight of 249.24 g/mol. Its IUPAC name is 4-bromo-2,9-dimethyldecane.
Molecular Properties
| Compound Name | 4-bromo-2,9-dimethyldecane |
| PubChem CID | 83161521 |
| Molecular Formula | C12H25Br |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-bromo-2,9-dimethyldecane |
| SMILES | CC(C)CCCCC(Br)CC(C)C |
| InChI | InChI=1S/C12H25Br/c1-10(2)7-5-6-8-12(13)9-11(3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | QBORPOZEUKHCCE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,9-dimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,9-dimethyldecane?
The IUPAC name of 4-bromo-2,9-dimethyldecane (CID 83161521) is 4-bromo-2,9-dimethyldecane.
What is the SMILES notation for 4-bromo-2,9-dimethyldecane?
The canonical SMILES for 4-bromo-2,9-dimethyldecane is CC(C)CCCCC(Br)CC(C)C.
What is the InChIKey of 4-bromo-2,9-dimethyldecane?
The InChIKey is QBORPOZEUKHCCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Br/c1-10(2)7-5-6-8-12(13)9-11(3)4/h10-12H,5-9H2,1-4H3.
What are the key properties of 4-bromo-2,9-dimethyldecane?
4-bromo-2,9-dimethyldecane has a molecular weight of 249.24 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,9-dimethyldecane is sourced from PubChem (CID 83161521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).