About 2,4-dibromooctane
2,4-dibromooctane (PubChem CID 150795215) has the molecular formula C8H16Br2
and a molecular weight of 272.02 g/mol. Its IUPAC name is 2,4-dibromooctane.
Molecular Properties
| Compound Name | 2,4-dibromooctane |
| PubChem CID | 150795215 |
| Molecular Formula | C8H16Br2 |
| Molecular Weight | 272.02 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 2,4-dibromooctane |
| SMILES | CCCCC(Br)CC(C)Br |
| InChI | InChI=1S/C8H16Br2/c1-3-4-5-8(10)6-7(2)9/h7-8H,3-6H2,1-2H3 |
| InChIKey | KERPUASTCQGWRQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromooctane?
The IUPAC name of 2,4-dibromooctane (CID 150795215) is 2,4-dibromooctane.
What is the SMILES notation for 2,4-dibromooctane?
The canonical SMILES for 2,4-dibromooctane is CCCCC(Br)CC(C)Br.
What is the InChIKey of 2,4-dibromooctane?
The InChIKey is KERPUASTCQGWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Br2/c1-3-4-5-8(10)6-7(2)9/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,4-dibromooctane?
2,4-dibromooctane has a molecular weight of 272.02 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromooctane is sourced from PubChem (CID 150795215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).