About cobalt;2-methylheptane
cobalt;2-methylheptane (PubChem CID 170567086) has the molecular formula C8H17Co-
and a molecular weight of 172.16 g/mol. Its IUPAC name is cobalt;2-methylheptane.
Molecular Properties
| Compound Name | cobalt;2-methylheptane |
| PubChem CID | 170567086 |
| Molecular Formula | C8H17Co- |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | cobalt;2-methylheptane |
| SMILES | [CH2-]CCCCC(C)C.[Co] |
| InChI | InChI=1S/C8H17.Co/c1-4-5-6-7-8(2)3;/h8H,1,4-7H2,2-3H3;/q-1; |
| InChIKey | SKHXWAOXLSIUJO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-methylheptane?
The IUPAC name of cobalt;2-methylheptane (CID 170567086) is cobalt;2-methylheptane.
What is the SMILES notation for cobalt;2-methylheptane?
The canonical SMILES for cobalt;2-methylheptane is [CH2-]CCCCC(C)C.[Co].
What is the InChIKey of cobalt;2-methylheptane?
The InChIKey is SKHXWAOXLSIUJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.Co/c1-4-5-6-7-8(2)3;/h8H,1,4-7H2,2-3H3;/q-1;.
What are the key properties of cobalt;2-methylheptane?
cobalt;2-methylheptane has a molecular weight of 172.16 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-methylheptane is sourced from PubChem (CID 170567086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).