About magnesium;2-methylheptane;propane
magnesium;2-methylheptane;propane (PubChem CID 140617225) has the molecular formula C11H24Mg
and a molecular weight of 180.62 g/mol. Its IUPAC name is magnesium;2-methylheptane;propane.
Molecular Properties
| Compound Name | magnesium;2-methylheptane;propane |
| PubChem CID | 140617225 |
| Molecular Formula | C11H24Mg |
| Molecular Weight | 180.62 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | magnesium;2-methylheptane;propane |
| SMILES | [CH2-]CC.[CH2-]CCCCC(C)C.[Mg+2] |
| InChI | InChI=1S/C8H17.C3H7.Mg/c1-4-5-6-7-8(2)3;1-3-2;/h8H,1,4-7H2,2-3H3;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | HNUOCSRQROUPAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methylheptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methylheptane;propane?
The IUPAC name of magnesium;2-methylheptane;propane (CID 140617225) is magnesium;2-methylheptane;propane.
What is the SMILES notation for magnesium;2-methylheptane;propane?
The canonical SMILES for magnesium;2-methylheptane;propane is [CH2-]CC.[CH2-]CCCCC(C)C.[Mg+2].
What is the InChIKey of magnesium;2-methylheptane;propane?
The InChIKey is HNUOCSRQROUPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.C3H7.Mg/c1-4-5-6-7-8(2)3;1-3-2;/h8H,1,4-7H2,2-3H3;1,3H2,2H3;/q2*-1;+2.
What are the key properties of magnesium;2-methylheptane;propane?
magnesium;2-methylheptane;propane has a molecular weight of 180.62 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methylheptane;propane is sourced from PubChem (CID 140617225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).